C10H13F4N — CID 106289652
N-(2,2,3,3-tetrafluoropropyl)bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 106289652) has the molecular formula C10H13F4N and a molecular weight of 223.21 g/mol. Its IUPAC name is N-(2,2,3,3-tetrafluoropropyl)bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-(2,2,3,3-tetrafluoropropyl)bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 106289652 |
| Molecular Formula | C10H13F4N |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N-(2,2,3,3-tetrafluoropropyl)bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | FC(F)C(F)(F)CNC1CC2CC=CC21 |
| InChI | InChI=1S/C10H13F4N/c11-9(12)10(13,14)5-15-8-4-6-2-1-3-7(6)8/h1,3,6-9,15H,2,4-5H2 |
| InChIKey | YWNKRCBTKHDUCQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|