C9H13F2N — CID 115406101
N-(2,2-difluoroethyl)bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 115406101) has the molecular formula C9H13F2N and a molecular weight of 173.21 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-(2,2-difluoroethyl)bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 115406101 |
| Molecular Formula | C9H13F2N |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | N-(2,2-difluoroethyl)bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | FC(F)CNC1CC2CC=CC21 |
| InChI | InChI=1S/C9H13F2N/c10-9(11)5-12-8-4-6-2-1-3-7(6)8/h1,3,6-9,12H,2,4-5H2 |
| InChIKey | WDYUXBXOLMQICM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|