C15H27N3O3 — CID 43791646
ethyl 4-[(4-carbamoylcyclohexyl)amino]piperidine-1-carboxylate (PubChem CID 43791646) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is ethyl 4-[(4-carbamoylcyclohexyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4-carbamoylcyclohexyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 43791646 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | ethyl 4-[(4-carbamoylcyclohexyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC2CCC(C(N)=O)CC2)CC1 |
| InChI | InChI=1S/C15H27N3O3/c1-2-21-15(20)18-9-7-13(8-10-18)17-12-5-3-11(4-6-12)14(16)19/h11-13,17H,2-10H2,1H3,(H2,16,19) |
| InChIKey | KHJUDVYKTYAJMN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |