C17H24IN3 — CID 43791898
1-imidazol-1-yl-N-[1-(4-iodophenyl)ethyl]-3,3-dimethylbutan-2-amine (PubChem CID 43791898) has the molecular formula C17H24IN3 and a molecular weight of 397.30 g/mol. Its IUPAC name is 1-imidazol-1-yl-N-[1-(4-iodophenyl)ethyl]-3,3-dimethylbutan-2-amine.
| Compound Name | 1-imidazol-1-yl-N-[1-(4-iodophenyl)ethyl]-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 43791898 |
| Molecular Formula | C17H24IN3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 1-imidazol-1-yl-N-[1-(4-iodophenyl)ethyl]-3,3-dimethylbutan-2-amine |
| SMILES | CC(NC(Cn1ccnc1)C(C)(C)C)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H24IN3/c1-13(14-5-7-15(18)8-6-14)20-16(17(2,3)4)11-21-10-9-19-12-21/h5-10,12-13,16,20H,11H2,1-4H3 |
| InChIKey | YRHTVWWTLPYTRY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|