C16H23NO — CID 43794990
2-[cyclopropyl(ethyl)amino]-1-(4-ethylphenyl)propan-1-one (PubChem CID 43794990) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-[cyclopropyl(ethyl)amino]-1-(4-ethylphenyl)propan-1-one.
| Compound Name | 2-[cyclopropyl(ethyl)amino]-1-(4-ethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 43794990 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2-[cyclopropyl(ethyl)amino]-1-(4-ethylphenyl)propan-1-one |
| SMILES | CCc1ccc(C(=O)C(C)N(CC)C2CC2)cc1 |
| InChI | InChI=1S/C16H23NO/c1-4-13-6-8-14(9-7-13)16(18)12(3)17(5-2)15-10-11-15/h6-9,12,15H,4-5,10-11H2,1-3H3 |
| InChIKey | NZRDWMABDMGOAV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |