C17H25NO — CID 43796353
2-[cyclopentyl(ethyl)amino]-1-(4-methylphenyl)propan-1-one (PubChem CID 43796353) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-[cyclopentyl(ethyl)amino]-1-(4-methylphenyl)propan-1-one.
| Compound Name | 2-[cyclopentyl(ethyl)amino]-1-(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 43796353 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-[cyclopentyl(ethyl)amino]-1-(4-methylphenyl)propan-1-one |
| SMILES | CCN(C1CCCC1)C(C)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H25NO/c1-4-18(16-7-5-6-8-16)14(3)17(19)15-11-9-13(2)10-12-15/h9-12,14,16H,4-8H2,1-3H3 |
| InChIKey | ABSFGDSMEUIPML-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |