C14H18F2O3 — CID 43800204
2-(2-butoxyethoxy)-1-(2,6-difluorophenyl)ethanone (PubChem CID 43800204) has the molecular formula C14H18F2O3 and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)-1-(2,6-difluorophenyl)ethanone.
| Compound Name | 2-(2-butoxyethoxy)-1-(2,6-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 43800204 |
| Molecular Formula | C14H18F2O3 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(2-butoxyethoxy)-1-(2,6-difluorophenyl)ethanone |
| SMILES | CCCCOCCOCC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H18F2O3/c1-2-3-7-18-8-9-19-10-13(17)14-11(15)5-4-6-12(14)16/h4-6H,2-3,7-10H2,1H3 |
| InChIKey | JNHGLVJIZAHDOG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|