C12H14F2O3 — CID 102927411
1-(2,6-difluorophenyl)-3-(2-methoxyethoxy)propan-1-one (PubChem CID 102927411) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(2-methoxyethoxy)propan-1-one.
| Compound Name | 1-(2,6-difluorophenyl)-3-(2-methoxyethoxy)propan-1-one |
|---|---|
| PubChem CID | 102927411 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(2-methoxyethoxy)propan-1-one |
| SMILES | COCCOCCC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C12H14F2O3/c1-16-7-8-17-6-5-11(15)12-9(13)3-2-4-10(12)14/h2-4H,5-8H2,1H3 |
| InChIKey | MHCOMAYHOVVKMU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|