C10H11F2O4P — CID 57052661
1-(2,6-difluorophenyl)-2-[methoxy(methyl)phosphoryl]oxyethanone (PubChem CID 57052661) has the molecular formula C10H11F2O4P and a molecular weight of 264.16 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-[methoxy(methyl)phosphoryl]oxyethanone.
| Compound Name | 1-(2,6-difluorophenyl)-2-[methoxy(methyl)phosphoryl]oxyethanone |
|---|---|
| PubChem CID | 57052661 |
| Molecular Formula | C10H11F2O4P |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-[methoxy(methyl)phosphoryl]oxyethanone |
| SMILES | COP(C)(=O)OCC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C10H11F2O4P/c1-15-17(2,14)16-6-9(13)10-7(11)4-3-5-8(10)12/h3-5H,6H2,1-2H3 |
| InChIKey | KIARJZWJNJGZMR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|