About 3-butoxybutan-2-one
3-butoxybutan-2-one (PubChem CID 43801213) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 3-butoxybutan-2-one.
Molecular Properties
| Compound Name | 3-butoxybutan-2-one |
| PubChem CID | 43801213 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 3-butoxybutan-2-one |
| SMILES | CCCCOC(C)C(C)=O |
| InChI | InChI=1S/C8H16O2/c1-4-5-6-10-8(3)7(2)9/h8H,4-6H2,1-3H3 |
| InChIKey | YYEPPYBHQFCKIL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxybutan-2-one?
The IUPAC name of 3-butoxybutan-2-one (CID 43801213) is 3-butoxybutan-2-one.
What is the SMILES notation for 3-butoxybutan-2-one?
The canonical SMILES for 3-butoxybutan-2-one is CCCCOC(C)C(C)=O.
What is the InChIKey of 3-butoxybutan-2-one?
The InChIKey is YYEPPYBHQFCKIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-4-5-6-10-8(3)7(2)9/h8H,4-6H2,1-3H3.
What are the key properties of 3-butoxybutan-2-one?
3-butoxybutan-2-one has a molecular weight of 144.21 g/mol, XLogP of 1.78, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxybutan-2-one is sourced from PubChem (CID 43801213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).