C14H13ClF3NO — CID 43804627
3-(4-chloronaphthalen-1-yl)oxy-4,4,4-trifluorobutan-1-amine (PubChem CID 43804627) has the molecular formula C14H13ClF3NO and a molecular weight of 303.71 g/mol. Its IUPAC name is 3-(4-chloronaphthalen-1-yl)oxy-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(4-chloronaphthalen-1-yl)oxy-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 43804627 |
| Molecular Formula | C14H13ClF3NO |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 3-(4-chloronaphthalen-1-yl)oxy-4,4,4-trifluorobutan-1-amine |
| SMILES | NCCC(Oc1ccc(Cl)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C14H13ClF3NO/c15-11-5-6-12(10-4-2-1-3-9(10)11)20-13(7-8-19)14(16,17)18/h1-6,13H,7-8,19H2 |
| InChIKey | HUBLMBQRLMPAQF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |