C18H26N2O — CID 43808408
3-cyclohexyl-N-(1,2,3,4-tetrahydroisoquinolin-5-yl)propanamide (PubChem CID 43808408) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-cyclohexyl-N-(1,2,3,4-tetrahydroisoquinolin-5-yl)propanamide.
| Compound Name | 3-cyclohexyl-N-(1,2,3,4-tetrahydroisoquinolin-5-yl)propanamide |
|---|---|
| PubChem CID | 43808408 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-cyclohexyl-N-(1,2,3,4-tetrahydroisoquinolin-5-yl)propanamide |
| SMILES | O=C(CCC1CCCCC1)Nc1cccc2c1CCNC2 |
| InChI | InChI=1S/C18H26N2O/c21-18(10-9-14-5-2-1-3-6-14)20-17-8-4-7-15-13-19-12-11-16(15)17/h4,7-8,14,19H,1-3,5-6,9-13H2,(H,20,21) |
| InChIKey | HAVODYQKKQGIHH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |