C13H17N3 — CID 43809487
6-N-methyl-6-N-propan-2-ylquinoline-5,6-diamine (PubChem CID 43809487) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 6-N-methyl-6-N-propan-2-ylquinoline-5,6-diamine.
| Compound Name | 6-N-methyl-6-N-propan-2-ylquinoline-5,6-diamine |
|---|---|
| PubChem CID | 43809487 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 6-N-methyl-6-N-propan-2-ylquinoline-5,6-diamine |
| SMILES | CC(C)N(C)c1ccc2ncccc2c1N |
| InChI | InChI=1S/C13H17N3/c1-9(2)16(3)12-7-6-11-10(13(12)14)5-4-8-15-11/h4-9H,14H2,1-3H3 |
| InChIKey | RZOORUHZNXUZLH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|