C14H18N4O — CID 43809689
2-[(5-aminoquinolin-6-yl)-methylamino]-N,N-dimethylacetamide (PubChem CID 43809689) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[(5-aminoquinolin-6-yl)-methylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(5-aminoquinolin-6-yl)-methylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 43809689 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-[(5-aminoquinolin-6-yl)-methylamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN(C)c1ccc2ncccc2c1N |
| InChI | InChI=1S/C14H18N4O/c1-17(2)13(19)9-18(3)12-7-6-11-10(14(12)15)5-4-8-16-11/h4-8H,9,15H2,1-3H3 |
| InChIKey | JTENUOJXXYHRIP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|