C23H20N4O3S — CID 43812548
2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 43812548) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 43812548 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | N#Cc1cc2cc3c(cc2nc1SCC(=O)Nc1ccc(N2CCCC2)cc1)OCO3 |
| InChI | InChI=1S/C23H20N4O3S/c24-12-16-9-15-10-20-21(30-14-29-20)11-19(15)26-23(16)31-13-22(28)25-17-3-5-18(6-4-17)27-7-1-2-8-27/h3-6,9-11H,1-2,7-8,13-14H2,(H,25,28) |
| InChIKey | NDXZSVBNEOWZOS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|