C17H16N4O2S2 — CID 43812728
2-[[3-(4-methoxyphenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-prop-2-enylacetamide (PubChem CID 43812728) has the molecular formula C17H16N4O2S2 and a molecular weight of 372.48 g/mol. Its IUPAC name is 2-[[3-(4-methoxyphenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[[3-(4-methoxyphenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 43812728 |
| Molecular Formula | C17H16N4O2S2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-[[3-(4-methoxyphenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1ncnc2c(-c3ccc(OC)cc3)nsc12 |
| InChI | InChI=1S/C17H16N4O2S2/c1-3-8-18-13(22)9-24-17-16-15(19-10-20-17)14(21-25-16)11-4-6-12(23-2)7-5-11/h3-7,10H,1,8-9H2,2H3,(H,18,22) |
| InChIKey | PBWOPDXHPKKLFN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|