C16H15ClN4O2S2 — CID 3214109
2-[[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-(2-methoxyethyl)acetamide (PubChem CID 3214109) has the molecular formula C16H15ClN4O2S2 and a molecular weight of 394.91 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 3214109 |
| Molecular Formula | C16H15ClN4O2S2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CSc1ncnc2c(-c3ccc(Cl)cc3)nsc12 |
| InChI | InChI=1S/C16H15ClN4O2S2/c1-23-7-6-18-12(22)8-24-16-15-14(19-9-20-16)13(21-25-15)10-2-4-11(17)5-3-10/h2-5,9H,6-8H2,1H3,(H,18,22) |
| InChIKey | QAHXCPSFCKYGDW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|