C25H26N2O2S — CID 43814195
N-(3-acetylphenyl)-2-[3-(cyclopentylmethyl)quinolin-2-yl]sulfanylacetamide (PubChem CID 43814195) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[3-(cyclopentylmethyl)quinolin-2-yl]sulfanylacetamide.
| Compound Name | N-(3-acetylphenyl)-2-[3-(cyclopentylmethyl)quinolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 43814195 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-(3-acetylphenyl)-2-[3-(cyclopentylmethyl)quinolin-2-yl]sulfanylacetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CSc2nc3ccccc3cc2CC2CCCC2)c1 |
| InChI | InChI=1S/C25H26N2O2S/c1-17(28)19-10-6-11-22(15-19)26-24(29)16-30-25-21(13-18-7-2-3-8-18)14-20-9-4-5-12-23(20)27-25/h4-6,9-12,14-15,18H,2-3,7-8,13,16H2,1H3,(H,26,29) |
| InChIKey | QEGQWUQLXPVSMJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |