C16H20N4O3S — CID 43814259
N-[2-(tert-butylamino)-2-oxoethyl]-N-(3-methoxyphenyl)thiadiazole-4-carboxamide (PubChem CID 43814259) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-N-(3-methoxyphenyl)thiadiazole-4-carboxamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-N-(3-methoxyphenyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 43814259 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-N-(3-methoxyphenyl)thiadiazole-4-carboxamide |
| SMILES | COc1cccc(N(CC(=O)NC(C)(C)C)C(=O)c2csnn2)c1 |
| InChI | InChI=1S/C16H20N4O3S/c1-16(2,3)17-14(21)9-20(15(22)13-10-24-19-18-13)11-6-5-7-12(8-11)23-4/h5-8,10H,9H2,1-4H3,(H,17,21) |
| InChIKey | GSUKJTLNELHBOB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |