C21H20N4O3S — CID 24793351
N-(3-acetylphenyl)-N-[2-oxo-2-(2-phenylethylamino)ethyl]thiadiazole-4-carboxamide (PubChem CID 24793351) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is N-(3-acetylphenyl)-N-[2-oxo-2-(2-phenylethylamino)ethyl]thiadiazole-4-carboxamide.
| Compound Name | N-(3-acetylphenyl)-N-[2-oxo-2-(2-phenylethylamino)ethyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 24793351 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-(3-acetylphenyl)-N-[2-oxo-2-(2-phenylethylamino)ethyl]thiadiazole-4-carboxamide |
| SMILES | CC(=O)c1cccc(N(CC(=O)NCCc2ccccc2)C(=O)c2csnn2)c1 |
| InChI | InChI=1S/C21H20N4O3S/c1-15(26)17-8-5-9-18(12-17)25(21(28)19-14-29-24-23-19)13-20(27)22-11-10-16-6-3-2-4-7-16/h2-9,12,14H,10-11,13H2,1H3,(H,22,27) |
| InChIKey | WSDXWCZMZSMWAI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |