C18H18N4O2S2 — CID 3670704
N-[2-oxo-2-(2-phenylethylamino)ethyl]-N-(thiophen-2-ylmethyl)thiadiazole-4-carboxamide (PubChem CID 3670704) has the molecular formula C18H18N4O2S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[2-oxo-2-(2-phenylethylamino)ethyl]-N-(thiophen-2-ylmethyl)thiadiazole-4-carboxamide.
| Compound Name | N-[2-oxo-2-(2-phenylethylamino)ethyl]-N-(thiophen-2-ylmethyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 3670704 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-[2-oxo-2-(2-phenylethylamino)ethyl]-N-(thiophen-2-ylmethyl)thiadiazole-4-carboxamide |
| SMILES | O=C(CN(Cc1cccs1)C(=O)c1csnn1)NCCc1ccccc1 |
| InChI | InChI=1S/C18H18N4O2S2/c23-17(19-9-8-14-5-2-1-3-6-14)12-22(11-15-7-4-10-25-15)18(24)16-13-26-21-20-16/h1-7,10,13H,8-9,11-12H2,(H,19,23) |
| InChIKey | QUQPFTJVYBETJC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |