C25H28N4O2S — CID 3221963
N-(4-cyclohexylphenyl)-N-[2-oxo-2-(2-phenylethylamino)ethyl]thiadiazole-4-carboxamide (PubChem CID 3221963) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)-N-[2-oxo-2-(2-phenylethylamino)ethyl]thiadiazole-4-carboxamide.
| Compound Name | N-(4-cyclohexylphenyl)-N-[2-oxo-2-(2-phenylethylamino)ethyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 3221963 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-(4-cyclohexylphenyl)-N-[2-oxo-2-(2-phenylethylamino)ethyl]thiadiazole-4-carboxamide |
| SMILES | O=C(CN(C(=O)c1csnn1)c1ccc(C2CCCCC2)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C25H28N4O2S/c30-24(26-16-15-19-7-3-1-4-8-19)17-29(25(31)23-18-32-28-27-23)22-13-11-21(12-14-22)20-9-5-2-6-10-20/h1,3-4,7-8,11-14,18,20H,2,5-6,9-10,15-17H2,(H,26,30) |
| InChIKey | YLKVFDXDKLHOQT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |