C24H21N3O4 — CID 43816379
N-(2-benzyl-4-oxoquinazolin-3-yl)-3,4-dimethoxybenzamide (PubChem CID 43816379) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-(2-benzyl-4-oxoquinazolin-3-yl)-3,4-dimethoxybenzamide.
| Compound Name | N-(2-benzyl-4-oxoquinazolin-3-yl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 43816379 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-(2-benzyl-4-oxoquinazolin-3-yl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nn2c(Cc3ccccc3)nc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C24H21N3O4/c1-30-20-13-12-17(15-21(20)31-2)23(28)26-27-22(14-16-8-4-3-5-9-16)25-19-11-7-6-10-18(19)24(27)29/h3-13,15H,14H2,1-2H3,(H,26,28) |
| InChIKey | HYBWYSLDLXFVKJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |