C10H9N3O2 — CID 43822801
6-[(2-oxooxolan-3-yl)amino]pyridine-3-carbonitrile (PubChem CID 43822801) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 6-[(2-oxooxolan-3-yl)amino]pyridine-3-carbonitrile.
| Compound Name | 6-[(2-oxooxolan-3-yl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 43822801 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 6-[(2-oxooxolan-3-yl)amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NC2CCOC2=O)nc1 |
| InChI | InChI=1S/C10H9N3O2/c11-5-7-1-2-9(12-6-7)13-8-3-4-15-10(8)14/h1-2,6,8H,3-4H2,(H,12,13) |
| InChIKey | DCJQHQVYDLQZRC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |