2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride

C6H6BrClN2O4S2 — CID 43823049

IUPAC2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride
SMILESNS(=O)(=O)Nc1ccc(S(=O)(=O)Cl)c(Br)c1
InChIInChI=1S/C6H6BrClN2O4S2/c7-5-3-4(10-16(9,13)14)1-2-6(5)15(8,11)12/h1-3,10H,(H2,9,13,14)
InChIKeyRSQXONANEBGECE-UHFFFAOYSA-N
MW349.62 g/mol
LogP0.99
Rot. Bonds3

About 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride

2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride (PubChem CID 43823049) has the molecular formula C6H6BrClN2O4S2 and a molecular weight of 349.62 g/mol. Its IUPAC name is 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride.

Molecular Properties

Compound Name2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride
PubChem CID43823049
Molecular FormulaC6H6BrClN2O4S2
Molecular Weight349.62 g/mol
Exact Mass347.86
IUPAC Name2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride
SMILESNS(=O)(=O)Nc1ccc(S(=O)(=O)Cl)c(Br)c1
InChIInChI=1S/C6H6BrClN2O4S2/c7-5-3-4(10-16(9,13)14)1-2-6(5)15(8,11)12/h1-3,10H,(H2,9,13,14)
InChIKeyRSQXONANEBGECE-UHFFFAOYSA-N
XLogP0.99
TPSA106.33 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500349.62
LogP ≤ 50.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride?
The IUPAC name of 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride (CID 43823049) is 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride.
What is the SMILES notation for 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride?
The canonical SMILES for 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride is NS(=O)(=O)Nc1ccc(S(=O)(=O)Cl)c(Br)c1.
What is the InChIKey of 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride?
The InChIKey is RSQXONANEBGECE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrClN2O4S2/c7-5-3-4(10-16(9,13)14)1-2-6(5)15(8,11)12/h1-3,10H,(H2,9,13,14).
What are the key properties of 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride?
2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride has a molecular weight of 349.62 g/mol, XLogP of 0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride is sourced from PubChem (CID 43823049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).