C6H6BrClN2O4S2 — CID 43823049
2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride (PubChem CID 43823049) has the molecular formula C6H6BrClN2O4S2 and a molecular weight of 349.62 g/mol. Its IUPAC name is 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride.
| Compound Name | 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 43823049 |
| Molecular Formula | C6H6BrClN2O4S2 |
| Molecular Weight | 349.62 g/mol |
| Exact Mass | 347.86 |
| IUPAC Name | 2-bromo-4-(sulfamoylamino)benzenesulfonyl chloride |
| SMILES | NS(=O)(=O)Nc1ccc(S(=O)(=O)Cl)c(Br)c1 |
| InChI | InChI=1S/C6H6BrClN2O4S2/c7-5-3-4(10-16(9,13)14)1-2-6(5)15(8,11)12/h1-3,10H,(H2,9,13,14) |
| InChIKey | RSQXONANEBGECE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.62 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |