C18H18N2O2 — CID 43824545
3-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]methyl]benzonitrile (PubChem CID 43824545) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]methyl]benzonitrile.
| Compound Name | 3-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 43824545 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNCCc2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C18H18N2O2/c19-12-15-2-1-3-16(10-15)13-20-7-6-14-4-5-17-18(11-14)22-9-8-21-17/h1-5,10-11,20H,6-9,13H2 |
| InChIKey | DNCSRXFUPNHDJV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|