C13H21FN2 — CID 43830303
3-(4-fluorophenyl)-2-N,2-N-dimethylpentane-2,3-diamine (PubChem CID 43830303) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-N,2-N-dimethylpentane-2,3-diamine.
| Compound Name | 3-(4-fluorophenyl)-2-N,2-N-dimethylpentane-2,3-diamine |
|---|---|
| PubChem CID | 43830303 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 3-(4-fluorophenyl)-2-N,2-N-dimethylpentane-2,3-diamine |
| SMILES | CCC(N)(c1ccc(F)cc1)C(C)N(C)C |
| InChI | InChI=1S/C13H21FN2/c1-5-13(15,10(2)16(3)4)11-6-8-12(14)9-7-11/h6-10H,5,15H2,1-4H3 |
| InChIKey | KTAWNXFLONDLSX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |