C14H21ClN2 — CID 43830754
3-(4-chlorophenyl)-2-N,2-N-dimethylhex-5-ene-2,3-diamine (PubChem CID 43830754) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-N,2-N-dimethylhex-5-ene-2,3-diamine.
| Compound Name | 3-(4-chlorophenyl)-2-N,2-N-dimethylhex-5-ene-2,3-diamine |
|---|---|
| PubChem CID | 43830754 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-(4-chlorophenyl)-2-N,2-N-dimethylhex-5-ene-2,3-diamine |
| SMILES | C=CCC(N)(c1ccc(Cl)cc1)C(C)N(C)C |
| InChI | InChI=1S/C14H21ClN2/c1-5-10-14(16,11(2)17(3)4)12-6-8-13(15)9-7-12/h5-9,11H,1,10,16H2,2-4H3 |
| InChIKey | DCKCRIKMQGFGRZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|