C17H25FN2 — CID 43830345
3-(4-fluorophenyl)-5-methyl-2-pyrrolidin-1-ylhex-5-en-3-amine (PubChem CID 43830345) has the molecular formula C17H25FN2 and a molecular weight of 276.40 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-methyl-2-pyrrolidin-1-ylhex-5-en-3-amine.
| Compound Name | 3-(4-fluorophenyl)-5-methyl-2-pyrrolidin-1-ylhex-5-en-3-amine |
|---|---|
| PubChem CID | 43830345 |
| Molecular Formula | C17H25FN2 |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 3-(4-fluorophenyl)-5-methyl-2-pyrrolidin-1-ylhex-5-en-3-amine |
| SMILES | C=C(C)CC(N)(c1ccc(F)cc1)C(C)N1CCCC1 |
| InChI | InChI=1S/C17H25FN2/c1-13(2)12-17(19,14(3)20-10-4-5-11-20)15-6-8-16(18)9-7-15/h6-9,14H,1,4-5,10-12,19H2,2-3H3 |
| InChIKey | BWDWEPZUHSVGMI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|