C14H16N2O6 — CID 43834949
dimethyl (2Z)-2-[(2-hydroxybenzoyl)hydrazinylidene]pentanedioate (PubChem CID 43834949) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is dimethyl (2Z)-2-[(2-hydroxybenzoyl)hydrazinylidene]pentanedioate.
| Compound Name | dimethyl (2Z)-2-[(2-hydroxybenzoyl)hydrazinylidene]pentanedioate |
|---|---|
| PubChem CID | 43834949 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | dimethyl (2Z)-2-[(2-hydroxybenzoyl)hydrazinylidene]pentanedioate |
| SMILES | COC(=O)CC/C(=N/NC(=O)c1ccccc1O)C(=O)OC |
| InChI | InChI=1S/C14H16N2O6/c1-21-12(18)8-7-10(14(20)22-2)15-16-13(19)9-5-3-4-6-11(9)17/h3-6,17H,7-8H2,1-2H3,(H,16,19)/b15-10- |
| InChIKey | IBKHQGGPTZOYGV-GDNBJRDFSA-N |
| XLogP | 0.60 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|