C16H20N2O6 — CID 3619400
diethyl 2-[(2-hydroxybenzoyl)hydrazinylidene]-3-methylbutanedioate (PubChem CID 3619400) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is diethyl 2-[(2-hydroxybenzoyl)hydrazinylidene]-3-methylbutanedioate.
| Compound Name | diethyl 2-[(2-hydroxybenzoyl)hydrazinylidene]-3-methylbutanedioate |
|---|---|
| PubChem CID | 3619400 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | diethyl 2-[(2-hydroxybenzoyl)hydrazinylidene]-3-methylbutanedioate |
| SMILES | CCOC(=O)C(=NNC(=O)c1ccccc1O)C(C)C(=O)OCC |
| InChI | InChI=1S/C16H20N2O6/c1-4-23-15(21)10(3)13(16(22)24-5-2)17-18-14(20)11-8-6-7-9-12(11)19/h6-10,19H,4-5H2,1-3H3,(H,18,20) |
| InChIKey | LFQNRWGBKWHQAF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|