C18H21N2O5P — CID 6898837
N-[(E)-[diethoxyphosphoryl(phenyl)methylidene]amino]-2-hydroxybenzamide (PubChem CID 6898837) has the molecular formula C18H21N2O5P and a molecular weight of 376.35 g/mol. Its IUPAC name is N-[(E)-[diethoxyphosphoryl(phenyl)methylidene]amino]-2-hydroxybenzamide.
| Compound Name | N-[(E)-[diethoxyphosphoryl(phenyl)methylidene]amino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 6898837 |
| Molecular Formula | C18H21N2O5P |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[(E)-[diethoxyphosphoryl(phenyl)methylidene]amino]-2-hydroxybenzamide |
| SMILES | CCOP(=O)(OCC)/C(=N/NC(=O)c1ccccc1O)c1ccccc1 |
| InChI | InChI=1S/C18H21N2O5P/c1-3-24-26(23,25-4-2)18(14-10-6-5-7-11-14)20-19-17(22)15-12-8-9-13-16(15)21/h5-13,21H,3-4H2,1-2H3,(H,19,22)/b20-18+ |
| InChIKey | QKQOAIGDJDVWEZ-CZIZESTLSA-N |
| XLogP | 3.75 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|