C31H33N3O4S2 — CID 43837561
N-[3-[4-(4-benzylpiperidin-1-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenoxyacetamide (PubChem CID 43837561) has the molecular formula C31H33N3O4S2 and a molecular weight of 575.76 g/mol. Its IUPAC name is N-[3-[4-(4-benzylpiperidin-1-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenoxyacetamide.
| Compound Name | N-[3-[4-(4-benzylpiperidin-1-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 43837561 |
| Molecular Formula | C31H33N3O4S2 |
| Molecular Weight | 575.76 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | N-[3-[4-(4-benzylpiperidin-1-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)/N=C1\SC2CS(=O)(=O)CC2N1c1ccc(N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H33N3O4S2/c35-30(20-38-27-9-5-2-6-10-27)32-31-34(28-21-40(36,37)22-29(28)39-31)26-13-11-25(12-14-26)33-17-15-24(16-18-33)19-23-7-3-1-4-8-23/h1-14,24,28-29H,15-22H2/b32-31- |
| InChIKey | JCTRLDIRPUFFBE-MVJHLKBCSA-N |
| XLogP | 4.83 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.76 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|