C28H35N3O3S2 — CID 43837570
N-[3-[4-(4-benzylpiperidin-1-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-methylbutanamide (PubChem CID 43837570) has the molecular formula C28H35N3O3S2 and a molecular weight of 525.74 g/mol. Its IUPAC name is N-[3-[4-(4-benzylpiperidin-1-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-methylbutanamide.
| Compound Name | N-[3-[4-(4-benzylpiperidin-1-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-methylbutanamide |
|---|---|
| PubChem CID | 43837570 |
| Molecular Formula | C28H35N3O3S2 |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | N-[3-[4-(4-benzylpiperidin-1-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)/N=C1\SC2CS(=O)(=O)CC2N1c1ccc(N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H35N3O3S2/c1-20(2)16-27(32)29-28-31(25-18-36(33,34)19-26(25)35-28)24-10-8-23(9-11-24)30-14-12-22(13-15-30)17-21-6-4-3-5-7-21/h3-11,20,22,25-26H,12-19H2,1-2H3/b29-28- |
| InChIKey | SIFKVZLQKFVFSG-ZIADKAODSA-N |
| XLogP | 4.79 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|