C29H37N3O6S2 — CID 43838245
tert-butyl N-[1-[[3-(3-butoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 43838245) has the molecular formula C29H37N3O6S2 and a molecular weight of 587.76 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-(3-butoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-(3-butoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 43838245 |
| Molecular Formula | C29H37N3O6S2 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | tert-butyl N-[1-[[3-(3-butoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCOc1cccc(N2/C(=N/C(=O)C(Cc3ccccc3)NC(=O)OC(C)(C)C)SC3CS(=O)(=O)CC32)c1 |
| InChI | InChI=1S/C29H37N3O6S2/c1-5-6-15-37-22-14-10-13-21(17-22)32-24-18-40(35,36)19-25(24)39-27(32)31-26(33)23(16-20-11-8-7-9-12-20)30-28(34)38-29(2,3)4/h7-14,17,23-25H,5-6,15-16,18-19H2,1-4H3,(H,30,34)/b31-27- |
| InChIKey | YNISCSNKDQPZSB-QVTSOHHYSA-N |
| XLogP | 4.60 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|