C13H12BrClN2O3S2 — CID 43838487
N-[3-(4-bromophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-chloroacetamide (PubChem CID 43838487) has the molecular formula C13H12BrClN2O3S2 and a molecular weight of 423.74 g/mol. Its IUPAC name is N-[3-(4-bromophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-chloroacetamide.
| Compound Name | N-[3-(4-bromophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-chloroacetamide |
|---|---|
| PubChem CID | 43838487 |
| Molecular Formula | C13H12BrClN2O3S2 |
| Molecular Weight | 423.74 g/mol |
| Exact Mass | 421.92 |
| IUPAC Name | N-[3-(4-bromophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-chloroacetamide |
| SMILES | O=C(CCl)/N=C1\SC2CS(=O)(=O)CC2N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H12BrClN2O3S2/c14-8-1-3-9(4-2-8)17-10-6-22(19,20)7-11(10)21-13(17)16-12(18)5-15/h1-4,10-11H,5-7H2/b16-13- |
| InChIKey | NWXPMZNYVWKVQH-SSZFMOIBSA-N |
| XLogP | 2.29 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.74 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|