C18H14Br2N2O3S2 — CID 4504924
4-bromo-N-[3-(4-bromophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]benzamide (PubChem CID 4504924) has the molecular formula C18H14Br2N2O3S2 and a molecular weight of 530.26 g/mol. Its IUPAC name is 4-bromo-N-[3-(4-bromophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]benzamide.
| Compound Name | 4-bromo-N-[3-(4-bromophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 4504924 |
| Molecular Formula | C18H14Br2N2O3S2 |
| Molecular Weight | 530.26 g/mol |
| Exact Mass | 527.88 |
| IUPAC Name | 4-bromo-N-[3-(4-bromophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]benzamide |
| SMILES | O=C(/N=C1\SC2CS(=O)(=O)CC2N1c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H14Br2N2O3S2/c19-12-3-1-11(2-4-12)17(23)21-18-22(14-7-5-13(20)6-8-14)15-9-27(24,25)10-16(15)26-18/h1-8,15-16H,9-10H2/b21-18- |
| InChIKey | JETIBLPXULCUMA-UZYVYHOESA-N |
| XLogP | 4.13 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.26 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|