C21H21BrFN3O3S2 — CID 43839301
2-[[3-(4-bromo-2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 43839301) has the molecular formula C21H21BrFN3O3S2 and a molecular weight of 526.45 g/mol. Its IUPAC name is 2-[[3-(4-bromo-2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[[3-(4-bromo-2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 43839301 |
| Molecular Formula | C21H21BrFN3O3S2 |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 525.02 |
| IUPAC Name | 2-[[3-(4-bromo-2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CSC1=NC2CS(=O)(=O)CC2N1c1ccc(Br)cc1F |
| InChI | InChI=1S/C21H21BrFN3O3S2/c1-12-4-3-5-13(2)20(12)25-19(27)9-30-21-24-16-10-31(28,29)11-18(16)26(21)17-7-6-14(22)8-15(17)23/h3-8,16,18H,9-11H2,1-2H3,(H,25,27) |
| InChIKey | MQJFDSSOKLYANA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |