About ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate
ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate (PubChem CID 43839823) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate |
| PubChem CID | 43839823 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate |
| SMILES | CCOC(=O)c1coc2c1C(=O)CC2 |
| InChI | InChI=1S/C10H10O4/c1-2-13-10(12)6-5-14-8-4-3-7(11)9(6)8/h5H,2-4H2,1H3 |
| InChIKey | AZCOJFWEXMORID-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate?
The IUPAC name of ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate (CID 43839823) is ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate.
What is the SMILES notation for ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate?
The canonical SMILES for ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate is CCOC(=O)c1coc2c1C(=O)CC2.
What is the InChIKey of ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate?
The InChIKey is AZCOJFWEXMORID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4/c1-2-13-10(12)6-5-14-8-4-3-7(11)9(6)8/h5H,2-4H2,1H3.
What are the key properties of ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate?
ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate has a molecular weight of 194.19 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxo-5,6-dihydrocyclopenta[b]furan-3-carboxylate is sourced from PubChem (CID 43839823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).