C19H18N2OS3 — CID 43845278
3-(phenylsulfanylmethyl)-5,16-dithia-2,7-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),6,10(15)-trien-8-one (PubChem CID 43845278) has the molecular formula C19H18N2OS3 and a molecular weight of 386.57 g/mol. Its IUPAC name is 3-(phenylsulfanylmethyl)-5,16-dithia-2,7-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),6,10(15)-trien-8-one.
| Compound Name | 3-(phenylsulfanylmethyl)-5,16-dithia-2,7-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),6,10(15)-trien-8-one |
|---|---|
| PubChem CID | 43845278 |
| Molecular Formula | C19H18N2OS3 |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3-(phenylsulfanylmethyl)-5,16-dithia-2,7-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),6,10(15)-trien-8-one |
| SMILES | O=c1nc2n(c3sc4c(c13)CCCC4)C(CSc1ccccc1)CS2 |
| InChI | InChI=1S/C19H18N2OS3/c22-17-16-14-8-4-5-9-15(14)25-18(16)21-12(11-24-19(21)20-17)10-23-13-6-2-1-3-7-13/h1-3,6-7,12H,4-5,8-11H2 |
| InChIKey | KSZPXZVSJDMIFA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |