C28H27N3O4 — CID 43854440
ethyl 1-benzyl-4-(2-ethoxyphenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 43854440) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is ethyl 1-benzyl-4-(2-ethoxyphenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl 1-benzyl-4-(2-ethoxyphenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 43854440 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | ethyl 1-benzyl-4-(2-ethoxyphenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)N(Cc2ccccc2)c2nc3ccccc3n2C1c1ccccc1OCC |
| InChI | InChI=1S/C28H27N3O4/c1-3-34-23-17-11-8-14-20(23)25-24(27(33)35-4-2)26(32)30(18-19-12-6-5-7-13-19)28-29-21-15-9-10-16-22(21)31(25)28/h5-17,24-25H,3-4,18H2,1-2H3 |
| InChIKey | XIBJZTBGQDTUOO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|