C26H22ClN3O3 — CID 43854425
ethyl 1-benzyl-4-(3-chlorophenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 43854425) has the molecular formula C26H22ClN3O3 and a molecular weight of 459.93 g/mol. Its IUPAC name is ethyl 1-benzyl-4-(3-chlorophenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl 1-benzyl-4-(3-chlorophenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 43854425 |
| Molecular Formula | C26H22ClN3O3 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | ethyl 1-benzyl-4-(3-chlorophenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)N(Cc2ccccc2)c2nc3ccccc3n2C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H22ClN3O3/c1-2-33-25(32)22-23(18-11-8-12-19(27)15-18)30-21-14-7-6-13-20(21)28-26(30)29(24(22)31)16-17-9-4-3-5-10-17/h3-15,22-23H,2,16H2,1H3 |
| InChIKey | PJFNTLTUKKSKGS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|