C29H27N3O4 — CID 43855874
5-(1,3-benzodioxol-5-ylmethyl)-4-(3-butoxyphenyl)-3-phenyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 43855874) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)-4-(3-butoxyphenyl)-3-phenyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)-4-(3-butoxyphenyl)-3-phenyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 43855874 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)-4-(3-butoxyphenyl)-3-phenyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCOc1cccc(C2c3c(-c4ccccc4)n[nH]c3C(=O)N2Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C29H27N3O4/c1-2-3-14-34-22-11-7-10-21(16-22)28-25-26(20-8-5-4-6-9-20)30-31-27(25)29(33)32(28)17-19-12-13-23-24(15-19)36-18-35-23/h4-13,15-16,28H,2-3,14,17-18H2,1H3,(H,30,31) |
| InChIKey | MDXGXMOBHQLBNU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|