C22H22ClN3O2S — CID 43857445
3-(4-chlorophenyl)-5-(3-methoxypropyl)-4-(4-methylsulfanylphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 43857445) has the molecular formula C22H22ClN3O2S and a molecular weight of 427.96 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-(3-methoxypropyl)-4-(4-methylsulfanylphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 3-(4-chlorophenyl)-5-(3-methoxypropyl)-4-(4-methylsulfanylphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 43857445 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 3-(4-chlorophenyl)-5-(3-methoxypropyl)-4-(4-methylsulfanylphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | COCCCN1C(=O)c2[nH]nc(-c3ccc(Cl)cc3)c2C1c1ccc(SC)cc1 |
| InChI | InChI=1S/C22H22ClN3O2S/c1-28-13-3-12-26-21(15-6-10-17(29-2)11-7-15)18-19(24-25-20(18)22(26)27)14-4-8-16(23)9-5-14/h4-11,21H,3,12-13H2,1-2H3,(H,24,25) |
| InChIKey | MXSXJNNIHAKIII-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|