C30H30ClN3O3 — CID 43859357
4-[4-[(2-chlorophenyl)methoxy]phenyl]-3-(4-methoxyphenyl)-5-pentyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 43859357) has the molecular formula C30H30ClN3O3 and a molecular weight of 516.04 g/mol. Its IUPAC name is 4-[4-[(2-chlorophenyl)methoxy]phenyl]-3-(4-methoxyphenyl)-5-pentyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 4-[4-[(2-chlorophenyl)methoxy]phenyl]-3-(4-methoxyphenyl)-5-pentyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 43859357 |
| Molecular Formula | C30H30ClN3O3 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 4-[4-[(2-chlorophenyl)methoxy]phenyl]-3-(4-methoxyphenyl)-5-pentyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCCN1C(=O)c2[nH]nc(-c3ccc(OC)cc3)c2C1c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C30H30ClN3O3/c1-3-4-7-18-34-29(21-12-16-24(17-13-21)37-19-22-8-5-6-9-25(22)31)26-27(32-33-28(26)30(34)35)20-10-14-23(36-2)15-11-20/h5-6,8-17,29H,3-4,7,18-19H2,1-2H3,(H,32,33) |
| InChIKey | ABCNADOKYGHISE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|