C19H16Cl2N2O2 — CID 43860427
7-chloro-N-(2-chlorophenyl)-1-ethyl-8-methyl-4-oxoquinoline-3-carboxamide (PubChem CID 43860427) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is 7-chloro-N-(2-chlorophenyl)-1-ethyl-8-methyl-4-oxoquinoline-3-carboxamide.
| Compound Name | 7-chloro-N-(2-chlorophenyl)-1-ethyl-8-methyl-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 43860427 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 7-chloro-N-(2-chlorophenyl)-1-ethyl-8-methyl-4-oxoquinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2ccccc2Cl)c(=O)c2ccc(Cl)c(C)c21 |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-3-23-10-13(19(25)22-16-7-5-4-6-15(16)21)18(24)12-8-9-14(20)11(2)17(12)23/h4-10H,3H2,1-2H3,(H,22,25) |
| InChIKey | WMYWLEZKPGQHID-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |