C18H16ClN3O2 — CID 43860417
7-chloro-1-ethyl-8-methyl-4-oxo-N-pyridin-2-ylquinoline-3-carboxamide (PubChem CID 43860417) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is 7-chloro-1-ethyl-8-methyl-4-oxo-N-pyridin-2-ylquinoline-3-carboxamide.
| Compound Name | 7-chloro-1-ethyl-8-methyl-4-oxo-N-pyridin-2-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 43860417 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 7-chloro-1-ethyl-8-methyl-4-oxo-N-pyridin-2-ylquinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2ccccn2)c(=O)c2ccc(Cl)c(C)c21 |
| InChI | InChI=1S/C18H16ClN3O2/c1-3-22-10-13(18(24)21-15-6-4-5-9-20-15)17(23)12-7-8-14(19)11(2)16(12)22/h4-10H,3H2,1-2H3,(H,20,21,24) |
| InChIKey | PWONUEGLMRXJKB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |