C18H17N3O5S2 — CID 43861803
6-[(E)-[(2E)-3-ethyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-ylidene]methyl]-2,3-dimethoxybenzoic acid (PubChem CID 43861803) has the molecular formula C18H17N3O5S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is 6-[(E)-[(2E)-3-ethyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-ylidene]methyl]-2,3-dimethoxybenzoic acid.
| Compound Name | 6-[(E)-[(2E)-3-ethyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-ylidene]methyl]-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 43861803 |
| Molecular Formula | C18H17N3O5S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 6-[(E)-[(2E)-3-ethyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-ylidene]methyl]-2,3-dimethoxybenzoic acid |
| SMILES | CCN1C(=O)/C(=C\c2ccc(OC)c(OC)c2C(=O)O)S/C1=N/c1nccs1 |
| InChI | InChI=1S/C18H17N3O5S2/c1-4-21-15(22)12(28-18(21)20-17-19-7-8-27-17)9-10-5-6-11(25-2)14(26-3)13(10)16(23)24/h5-9H,4H2,1-3H3,(H,23,24)/b12-9+,20-18+ |
| InChIKey | MWYOKNOBYNPLKC-ABMJUWQSSA-N |
| XLogP | 3.48 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|