C16H13N3O4S2 — CID 43862538
2-[2-[(E)-[(2E)-3-methyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 43862538) has the molecular formula C16H13N3O4S2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-[2-[(E)-[(2E)-3-methyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-[(2E)-3-methyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 43862538 |
| Molecular Formula | C16H13N3O4S2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 2-[2-[(E)-[(2E)-3-methyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | CN1C(=O)/C(=C\c2ccccc2OCC(=O)O)S/C1=N/c1nccs1 |
| InChI | InChI=1S/C16H13N3O4S2/c1-19-14(22)12(25-16(19)18-15-17-6-7-24-15)8-10-4-2-3-5-11(10)23-9-13(20)21/h2-8H,9H2,1H3,(H,20,21)/b12-8+,18-16+ |
| InChIKey | YJTXHFZUFVBPRU-NOIVRZSOSA-N |
| XLogP | 2.84 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|