C25H26N2O6S2 — CID 43863148
2-[4-[(E)-[3-[(4-tert-butylbenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 43863148) has the molecular formula C25H26N2O6S2 and a molecular weight of 514.63 g/mol. Its IUPAC name is 2-[4-[(E)-[3-[(4-tert-butylbenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | 2-[4-[(E)-[3-[(4-tert-butylbenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 43863148 |
| Molecular Formula | C25H26N2O6S2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | 2-[4-[(E)-[3-[(4-tert-butylbenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | COc1cc(/C=C2/SC(=S)N(NC(=O)c3ccc(C(C)(C)C)cc3)C2=O)ccc1OC(C)C(=O)O |
| InChI | InChI=1S/C25H26N2O6S2/c1-14(23(30)31)33-18-11-6-15(12-19(18)32-5)13-20-22(29)27(24(34)35-20)26-21(28)16-7-9-17(10-8-16)25(2,3)4/h6-14H,1-5H3,(H,26,28)(H,30,31)/b20-13+ |
| InChIKey | YZBRYAIAFUSEDO-DEDYPNTBSA-N |
| XLogP | 4.39 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|